About azane;bis(3-methylphenyl) hydrogen phosphate
azane;bis(3-methylphenyl) hydrogen phosphate (PubChem CID 2843505) has the molecular formula C14H18NO4P
and a molecular weight of 295.28 g/mol. Its IUPAC name is azane;bis(3-methylphenyl) hydrogen phosphate.
Molecular Properties
| Compound Name | azane;bis(3-methylphenyl) hydrogen phosphate |
| PubChem CID | 2843505 |
| Molecular Formula | C14H18NO4P |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | azane;bis(3-methylphenyl) hydrogen phosphate |
| SMILES | Cc1cccc(OP(=O)(O)Oc2cccc(C)c2)c1.N |
| InChI | InChI=1S/C14H15O4P.H3N/c1-11-5-3-7-13(9-11)17-19(15,16)18-14-8-4-6-12(2)10-14;/h3-10H,1-2H3,(H,15,16);1H3 |
| InChIKey | VLGUXUHOSVCLNO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;bis(3-methylphenyl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;bis(3-methylphenyl) hydrogen phosphate?
The IUPAC name of azane;bis(3-methylphenyl) hydrogen phosphate (CID 2843505) is azane;bis(3-methylphenyl) hydrogen phosphate.
What is the SMILES notation for azane;bis(3-methylphenyl) hydrogen phosphate?
The canonical SMILES for azane;bis(3-methylphenyl) hydrogen phosphate is Cc1cccc(OP(=O)(O)Oc2cccc(C)c2)c1.N.
What is the InChIKey of azane;bis(3-methylphenyl) hydrogen phosphate?
The InChIKey is VLGUXUHOSVCLNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15O4P.H3N/c1-11-5-3-7-13(9-11)17-19(15,16)18-14-8-4-6-12(2)10-14;/h3-10H,1-2H3,(H,15,16);1H3.
What are the key properties of azane;bis(3-methylphenyl) hydrogen phosphate?
azane;bis(3-methylphenyl) hydrogen phosphate has a molecular weight of 295.28 g/mol, XLogP of 4.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;bis(3-methylphenyl) hydrogen phosphate is sourced from PubChem (CID 2843505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).