About diphenyl hydrogen phosphate;silane
diphenyl hydrogen phosphate;silane (PubChem CID 175425543) has the molecular formula C12H15O4PSi
and a molecular weight of 282.31 g/mol. Its IUPAC name is diphenyl hydrogen phosphate;silane.
Molecular Properties
| Compound Name | diphenyl hydrogen phosphate;silane |
| PubChem CID | 175425543 |
| Molecular Formula | C12H15O4PSi |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | diphenyl hydrogen phosphate;silane |
| SMILES | O=P(O)(Oc1ccccc1)Oc1ccccc1.[SiH4] |
| InChI | InChI=1S/C12H11O4P.H4Si/c13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;/h1-10H,(H,13,14);1H4 |
| InChIKey | TZPJQMTXNHVHQI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenyl hydrogen phosphate;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl hydrogen phosphate;silane?
The IUPAC name of diphenyl hydrogen phosphate;silane (CID 175425543) is diphenyl hydrogen phosphate;silane.
What is the SMILES notation for diphenyl hydrogen phosphate;silane?
The canonical SMILES for diphenyl hydrogen phosphate;silane is O=P(O)(Oc1ccccc1)Oc1ccccc1.[SiH4].
What is the InChIKey of diphenyl hydrogen phosphate;silane?
The InChIKey is TZPJQMTXNHVHQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O4P.H4Si/c13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;/h1-10H,(H,13,14);1H4.
What are the key properties of diphenyl hydrogen phosphate;silane?
diphenyl hydrogen phosphate;silane has a molecular weight of 282.31 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl hydrogen phosphate;silane is sourced from PubChem (CID 175425543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).