About diphenyl hydrogen phosphate;N-phenylaniline
diphenyl hydrogen phosphate;N-phenylaniline (PubChem CID 172852100) has the molecular formula C24H22NO4P
and a molecular weight of 419.42 g/mol. Its IUPAC name is diphenyl hydrogen phosphate;N-phenylaniline.
Molecular Properties
| Compound Name | diphenyl hydrogen phosphate;N-phenylaniline |
| PubChem CID | 172852100 |
| Molecular Formula | C24H22NO4P |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | diphenyl hydrogen phosphate;N-phenylaniline |
| SMILES | O=P(O)(Oc1ccccc1)Oc1ccccc1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C12H11O4P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10,13H;1-10H,(H,13,14) |
| InChIKey | YEZLDWRGHNWJJN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenyl hydrogen phosphate;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl hydrogen phosphate;N-phenylaniline?
The IUPAC name of diphenyl hydrogen phosphate;N-phenylaniline (CID 172852100) is diphenyl hydrogen phosphate;N-phenylaniline.
What is the SMILES notation for diphenyl hydrogen phosphate;N-phenylaniline?
The canonical SMILES for diphenyl hydrogen phosphate;N-phenylaniline is O=P(O)(Oc1ccccc1)Oc1ccccc1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of diphenyl hydrogen phosphate;N-phenylaniline?
The InChIKey is YEZLDWRGHNWJJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C12H11O4P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10,13H;1-10H,(H,13,14).
What are the key properties of diphenyl hydrogen phosphate;N-phenylaniline?
diphenyl hydrogen phosphate;N-phenylaniline has a molecular weight of 419.42 g/mol, XLogP of 6.68, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl hydrogen phosphate;N-phenylaniline is sourced from PubChem (CID 172852100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).