C11H10N2S2 — CID 154138240
1,2-diisothiocyanato-3-propylbenzene (PubChem CID 154138240) has the molecular formula C11H10N2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 1,2-diisothiocyanato-3-propylbenzene.
| Compound Name | 1,2-diisothiocyanato-3-propylbenzene |
|---|---|
| PubChem CID | 154138240 |
| Molecular Formula | C11H10N2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1,2-diisothiocyanato-3-propylbenzene |
| SMILES | CCCc1cccc(N=C=S)c1N=C=S |
| InChI | InChI=1S/C11H10N2S2/c1-2-4-9-5-3-6-10(12-7-14)11(9)13-8-15/h3,5-6H,2,4H2,1H3 |
| InChIKey | YEZZBSRFAJKBPI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|