C17H8N4O4 — CID 11602399
1-[(2,3-diisocyanatophenyl)methyl]-2,3-diisocyanatobenzene (PubChem CID 11602399) has the molecular formula C17H8N4O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is 1-[(2,3-diisocyanatophenyl)methyl]-2,3-diisocyanatobenzene.
| Compound Name | 1-[(2,3-diisocyanatophenyl)methyl]-2,3-diisocyanatobenzene |
|---|---|
| PubChem CID | 11602399 |
| Molecular Formula | C17H8N4O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-[(2,3-diisocyanatophenyl)methyl]-2,3-diisocyanatobenzene |
| SMILES | O=C=Nc1cccc(Cc2cccc(N=C=O)c2N=C=O)c1N=C=O |
| InChI | InChI=1S/C17H8N4O4/c22-8-18-14-5-1-3-12(16(14)20-10-24)7-13-4-2-6-15(19-9-23)17(13)21-11-25/h1-6H,7H2 |
| InChIKey | PVEWOCBREBWSMS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|