About 1,2-diisocyanatochrysene
1,2-diisocyanatochrysene (PubChem CID 87779378) has the molecular formula C20H10N2O2
and a molecular weight of 310.31 g/mol. Its IUPAC name is 1,2-diisocyanatochrysene.
Molecular Properties
| Compound Name | 1,2-diisocyanatochrysene |
| PubChem CID | 87779378 |
| Molecular Formula | C20H10N2O2 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1,2-diisocyanatochrysene |
| SMILES | O=C=Nc1ccc2c(ccc3c4ccccc4ccc23)c1N=C=O |
| InChI | InChI=1S/C20H10N2O2/c23-11-21-19-10-9-17-16-6-5-13-3-1-2-4-14(13)15(16)7-8-18(17)20(19)22-12-24/h1-10H |
| InChIKey | RONMXHYRWZKDKO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diisocyanatochrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diisocyanatochrysene?
The IUPAC name of 1,2-diisocyanatochrysene (CID 87779378) is 1,2-diisocyanatochrysene.
What is the SMILES notation for 1,2-diisocyanatochrysene?
The canonical SMILES for 1,2-diisocyanatochrysene is O=C=Nc1ccc2c(ccc3c4ccccc4ccc23)c1N=C=O.
What is the InChIKey of 1,2-diisocyanatochrysene?
The InChIKey is RONMXHYRWZKDKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10N2O2/c23-11-21-19-10-9-17-16-6-5-13-3-1-2-4-14(13)15(16)7-8-18(17)20(19)22-12-24/h1-10H.
What are the key properties of 1,2-diisocyanatochrysene?
1,2-diisocyanatochrysene has a molecular weight of 310.31 g/mol, XLogP of 5.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diisocyanatochrysene is sourced from PubChem (CID 87779378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).