C16H10O2 — CID 22066356
tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,10,12,14-heptaene-8,9-dione (PubChem CID 22066356) has the molecular formula C16H10O2 and a molecular weight of 234.25 g/mol. Its IUPAC name is tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,10,12,14-heptaene-8,9-dione.
| Compound Name | tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,10,12,14-heptaene-8,9-dione |
|---|---|
| PubChem CID | 22066356 |
| Molecular Formula | C16H10O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,10,12,14-heptaene-8,9-dione |
| SMILES | O=c1ccc2ccccc2c2ccccc2c1=O |
| InChI | InChI=1S/C16H10O2/c17-15-10-9-11-5-1-2-6-12(11)13-7-3-4-8-14(13)16(15)18/h1-10H/b10-9- |
| InChIKey | YHCPCNJITKLMSE-KTKRTIGZSA-N |
| XLogP | 2.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|