C16H8O2 — CID 87349541
cyclopenta[a]fluorene-1,2-dione (PubChem CID 87349541) has the molecular formula C16H8O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is cyclopenta[a]fluorene-1,2-dione.
| Compound Name | cyclopenta[a]fluorene-1,2-dione |
|---|---|
| PubChem CID | 87349541 |
| Molecular Formula | C16H8O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | cyclopenta[a]fluorene-1,2-dione |
| SMILES | O=c1cc2ccc3c4ccccc4cc3c2c1=O |
| InChI | InChI=1S/C16H8O2/c17-14-8-10-5-6-12-11-4-2-1-3-9(11)7-13(12)15(10)16(14)18/h1-8H |
| InChIKey | VGXPJIRTWSRLKQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|