C24H16N4O4 — CID 160769129
2,4-diisocyanato-1-methylbenzene;1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene (PubChem CID 160769129) has the molecular formula C24H16N4O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is 2,4-diisocyanato-1-methylbenzene;1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene.
| Compound Name | 2,4-diisocyanato-1-methylbenzene;1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene |
|---|---|
| PubChem CID | 160769129 |
| Molecular Formula | C24H16N4O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene;1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.O=C=Nc1ccccc1Cc1ccccc1N=C=O |
| InChI | InChI=1S/C15H10N2O2.C9H6N2O2/c18-10-16-14-7-3-1-5-12(14)9-13-6-2-4-8-15(13)17-11-19;1-7-2-3-8(10-5-12)4-9(7)11-6-13/h1-8H,9H2;2-4H,1H3 |
| InChIKey | RZBQQMOPDAXLOS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|