C15H20N2O4 — CID 161059816
2,4-diisocyanato-1-methylbenzene;hexane-1,6-diol (PubChem CID 161059816) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2,4-diisocyanato-1-methylbenzene;hexane-1,6-diol.
| Compound Name | 2,4-diisocyanato-1-methylbenzene;hexane-1,6-diol |
|---|---|
| PubChem CID | 161059816 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene;hexane-1,6-diol |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.OCCCCCCO |
| InChI | InChI=1S/C9H6N2O2.C6H14O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;7-5-3-1-2-4-6-8/h2-4H,1H3;7-8H,1-6H2 |
| InChIKey | UDGDCXFNFXLHGN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|