C16H20N2O7 — CID 87603681
2,4-diisocyanato-1-methylbenzene;ethane-1,2-diol;2-hydroxyethyl prop-2-enoate (PubChem CID 87603681) has the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. Its IUPAC name is 2,4-diisocyanato-1-methylbenzene;ethane-1,2-diol;2-hydroxyethyl prop-2-enoate.
| Compound Name | 2,4-diisocyanato-1-methylbenzene;ethane-1,2-diol;2-hydroxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 87603681 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene;ethane-1,2-diol;2-hydroxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO.Cc1ccc(N=C=O)cc1N=C=O.OCCO |
| InChI | InChI=1S/C9H6N2O2.C5H8O3.C2H6O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;1-2-5(7)8-4-3-6;3-1-2-4/h2-4H,1H3;2,6H,1,3-4H2;3-4H,1-2H2 |
| InChIKey | NRYAXDVLKHLDQQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|