C9H6N2O3Zn — CID 162119581
zinc;2,4-diisocyanato-1-methylbenzene;oxygen(2-) (PubChem CID 162119581) has the molecular formula C9H6N2O3Zn and a molecular weight of 255.55 g/mol. Its IUPAC name is zinc;2,4-diisocyanato-1-methylbenzene;oxygen(2-).
| Compound Name | zinc;2,4-diisocyanato-1-methylbenzene;oxygen(2-) |
|---|---|
| PubChem CID | 162119581 |
| Molecular Formula | C9H6N2O3Zn |
| Molecular Weight | 255.55 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | zinc;2,4-diisocyanato-1-methylbenzene;oxygen(2-) |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.[O-2].[Zn+2] |
| InChI | InChI=1S/C9H6N2O2.O.Zn/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;;/h2-4H,1H3;;/q;-2;+2 |
| InChIKey | ZHFQAZGBUUQCOE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.55 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|