C12H6N4O5 — CID 175300596
carbonyl diisocyanate;2,4-diisocyanato-1-methylbenzene (PubChem CID 175300596) has the molecular formula C12H6N4O5 and a molecular weight of 286.20 g/mol. Its IUPAC name is carbonyl diisocyanate;2,4-diisocyanato-1-methylbenzene.
| Compound Name | carbonyl diisocyanate;2,4-diisocyanato-1-methylbenzene |
|---|---|
| PubChem CID | 175300596 |
| Molecular Formula | C12H6N4O5 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | carbonyl diisocyanate;2,4-diisocyanato-1-methylbenzene |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.O=C=NC(=O)N=C=O |
| InChI | InChI=1S/C9H6N2O2.C3N2O3/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;6-1-4-3(8)5-2-7/h2-4H,1H3; |
| InChIKey | XKEHQLXVDYGQAK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 134.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|