C21H33N3O8 — CID 170852790
2-[2-[bis[2-(2-hydroxyethoxy)ethyl]amino]ethoxy]ethanol;2,4-diisocyanato-1-methylbenzene (PubChem CID 170852790) has the molecular formula C21H33N3O8 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-[2-[bis[2-(2-hydroxyethoxy)ethyl]amino]ethoxy]ethanol;2,4-diisocyanato-1-methylbenzene.
| Compound Name | 2-[2-[bis[2-(2-hydroxyethoxy)ethyl]amino]ethoxy]ethanol;2,4-diisocyanato-1-methylbenzene |
|---|---|
| PubChem CID | 170852790 |
| Molecular Formula | C21H33N3O8 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 2-[2-[bis[2-(2-hydroxyethoxy)ethyl]amino]ethoxy]ethanol;2,4-diisocyanato-1-methylbenzene |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.OCCOCCN(CCOCCO)CCOCCO |
| InChI | InChI=1S/C12H27NO6.C9H6N2O2/c14-4-10-17-7-1-13(2-8-18-11-5-15)3-9-19-12-6-16;1-7-2-3-8(10-5-12)4-9(7)11-6-13/h14-16H,1-12H2;2-4H,1H3 |
| InChIKey | DEKHGUNMVKRSPQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|