About but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene
but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene (PubChem CID 22760842) has the molecular formula C13H14N2O4
and a molecular weight of 262.26 g/mol. Its IUPAC name is but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene.
Molecular Properties
| Compound Name | but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene |
| PubChem CID | 22760842 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene |
| SMILES | CCC=C(O)O.Cc1ccc(N=C=O)cc1N=C=O |
| InChI | InChI=1S/C9H6N2O2.C4H8O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;1-2-3-4(5)6/h2-4H,1H3;3,5-6H,2H2,1H3 |
| InChIKey | UUJNGQNPKLKNFQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene?
The IUPAC name of but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene (CID 22760842) is but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene.
What is the SMILES notation for but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene?
The canonical SMILES for but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene is CCC=C(O)O.Cc1ccc(N=C=O)cc1N=C=O.
What is the InChIKey of but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene?
The InChIKey is UUJNGQNPKLKNFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2.C4H8O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;1-2-3-4(5)6/h2-4H,1H3;3,5-6H,2H2,1H3.
What are the key properties of but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene?
but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene has a molecular weight of 262.26 g/mol, XLogP of 3.28, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene-1,1-diol;2,4-diisocyanato-1-methylbenzene is sourced from PubChem (CID 22760842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).