C11H10N4O3 — CID 160514739
2,4-diisocyanato-1-methylbenzene;methylideneurea (PubChem CID 160514739) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 2,4-diisocyanato-1-methylbenzene;methylideneurea.
| Compound Name | 2,4-diisocyanato-1-methylbenzene;methylideneurea |
|---|---|
| PubChem CID | 160514739 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene;methylideneurea |
| SMILES | C=NC(N)=O.Cc1ccc(N=C=O)cc1N=C=O |
| InChI | InChI=1S/C9H6N2O2.C2H4N2O/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;1-4-2(3)5/h2-4H,1H3;1H2,(H2,3,5) |
| InChIKey | QTMRQGDPYZBWTO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|