C9H7N2O2+ — CID 174698071
2,4-diisocyanato-1-methylbenzene;hydron (PubChem CID 174698071) has the molecular formula C9H7N2O2+ and a molecular weight of 175.17 g/mol. Its IUPAC name is 2,4-diisocyanato-1-methylbenzene;hydron.
| Compound Name | 2,4-diisocyanato-1-methylbenzene;hydron |
|---|---|
| PubChem CID | 174698071 |
| Molecular Formula | C9H7N2O2+ |
| Molecular Weight | 175.17 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene;hydron |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.[H+] |
| InChI | InChI=1S/C9H6N2O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13/h2-4H,1H3/p+1 |
| InChIKey | DVKJHBMWWAPEIU-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|