About benzene;1,2-diisocyanatobenzene
benzene;1,2-diisocyanatobenzene (PubChem CID 159551146) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is benzene;1,2-diisocyanatobenzene.
Molecular Properties
| Compound Name | benzene;1,2-diisocyanatobenzene |
| PubChem CID | 159551146 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | benzene;1,2-diisocyanatobenzene |
| SMILES | O=C=Nc1ccccc1N=C=O.c1ccccc1 |
| InChI | InChI=1S/C8H4N2O2.C6H6/c11-5-9-7-3-1-2-4-8(7)10-6-12;1-2-4-6-5-3-1/h1-4H;1-6H |
| InChIKey | MFKDIJMJJSGTHT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze benzene;1,2-diisocyanatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1,2-diisocyanatobenzene?
The IUPAC name of benzene;1,2-diisocyanatobenzene (CID 159551146) is benzene;1,2-diisocyanatobenzene.
What is the SMILES notation for benzene;1,2-diisocyanatobenzene?
The canonical SMILES for benzene;1,2-diisocyanatobenzene is O=C=Nc1ccccc1N=C=O.c1ccccc1.
What is the InChIKey of benzene;1,2-diisocyanatobenzene?
The InChIKey is MFKDIJMJJSGTHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O2.C6H6/c11-5-9-7-3-1-2-4-8(7)10-6-12;1-2-4-6-5-3-1/h1-4H;1-6H.
What are the key properties of benzene;1,2-diisocyanatobenzene?
benzene;1,2-diisocyanatobenzene has a molecular weight of 238.25 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1,2-diisocyanatobenzene is sourced from PubChem (CID 159551146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).