About 1-isocyanato-2,3-diphenylbenzene
1-isocyanato-2,3-diphenylbenzene (PubChem CID 154092434) has the molecular formula C19H13NO
and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-isocyanato-2,3-diphenylbenzene.
Molecular Properties
| Compound Name | 1-isocyanato-2,3-diphenylbenzene |
| PubChem CID | 154092434 |
| Molecular Formula | C19H13NO |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-isocyanato-2,3-diphenylbenzene |
| SMILES | O=C=Nc1cccc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H13NO/c21-14-20-18-13-7-12-17(15-8-3-1-4-9-15)19(18)16-10-5-2-6-11-16/h1-13H |
| InChIKey | PAKQAZNBCCNPOC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanato-2,3-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanato-2,3-diphenylbenzene?
The IUPAC name of 1-isocyanato-2,3-diphenylbenzene (CID 154092434) is 1-isocyanato-2,3-diphenylbenzene.
What is the SMILES notation for 1-isocyanato-2,3-diphenylbenzene?
The canonical SMILES for 1-isocyanato-2,3-diphenylbenzene is O=C=Nc1cccc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 1-isocyanato-2,3-diphenylbenzene?
The InChIKey is PAKQAZNBCCNPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO/c21-14-20-18-13-7-12-17(15-8-3-1-4-9-15)19(18)16-10-5-2-6-11-16/h1-13H.
What are the key properties of 1-isocyanato-2,3-diphenylbenzene?
1-isocyanato-2,3-diphenylbenzene has a molecular weight of 271.32 g/mol, XLogP of 4.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanato-2,3-diphenylbenzene is sourced from PubChem (CID 154092434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).