C26H16N2O2 — CID 175351835
2,4-diisocyanato-1,3,5-triphenylbenzene (PubChem CID 175351835) has the molecular formula C26H16N2O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2,4-diisocyanato-1,3,5-triphenylbenzene.
| Compound Name | 2,4-diisocyanato-1,3,5-triphenylbenzene |
|---|---|
| PubChem CID | 175351835 |
| Molecular Formula | C26H16N2O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2,4-diisocyanato-1,3,5-triphenylbenzene |
| SMILES | O=C=Nc1c(-c2ccccc2)cc(-c2ccccc2)c(N=C=O)c1-c1ccccc1 |
| InChI | InChI=1S/C26H16N2O2/c29-17-27-25-22(19-10-4-1-5-11-19)16-23(20-12-6-2-7-13-20)26(28-18-30)24(25)21-14-8-3-9-15-21/h1-16H |
| InChIKey | HWZMJRQVKIFASZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|