C15H13NO — CID 141258804
3-isocyanato-1,2-dimethyl-4-phenylbenzene (PubChem CID 141258804) has the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-isocyanato-1,2-dimethyl-4-phenylbenzene.
| Compound Name | 3-isocyanato-1,2-dimethyl-4-phenylbenzene |
|---|---|
| PubChem CID | 141258804 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-isocyanato-1,2-dimethyl-4-phenylbenzene |
| SMILES | Cc1ccc(-c2ccccc2)c(N=C=O)c1C |
| InChI | InChI=1S/C15H13NO/c1-11-8-9-14(13-6-4-3-5-7-13)15(12(11)2)16-10-17/h3-9H,1-2H3 |
| InChIKey | DNOYENGAXFHPKG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|