C14H18NP — CID 174680064
azane;(2,3-dimethyl-6-phenylphenyl)phosphane (PubChem CID 174680064) has the molecular formula C14H18NP and a molecular weight of 231.28 g/mol. Its IUPAC name is azane;(2,3-dimethyl-6-phenylphenyl)phosphane.
| Compound Name | azane;(2,3-dimethyl-6-phenylphenyl)phosphane |
|---|---|
| PubChem CID | 174680064 |
| Molecular Formula | C14H18NP |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | azane;(2,3-dimethyl-6-phenylphenyl)phosphane |
| SMILES | Cc1ccc(-c2ccccc2)c(P)c1C.N |
| InChI | InChI=1S/C14H15P.H3N/c1-10-8-9-13(14(15)11(10)2)12-6-4-3-5-7-12;/h3-9H,15H2,1-2H3;1H3 |
| InChIKey | ZDMYHNQWYLHAOJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|