About 2-tert-butyl-1,3-dimethyl-4-phenylbenzene
2-tert-butyl-1,3-dimethyl-4-phenylbenzene (PubChem CID 164927310) has the molecular formula C18H22
and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dimethyl-4-phenylbenzene.
Molecular Properties
| Compound Name | 2-tert-butyl-1,3-dimethyl-4-phenylbenzene |
| PubChem CID | 164927310 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-tert-butyl-1,3-dimethyl-4-phenylbenzene |
| SMILES | Cc1ccc(-c2ccccc2)c(C)c1C(C)(C)C |
| InChI | InChI=1S/C18H22/c1-13-11-12-16(15-9-7-6-8-10-15)14(2)17(13)18(3,4)5/h6-12H,1-5H3 |
| InChIKey | XDNAHXJESVNEQH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-1,3-dimethyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,3-dimethyl-4-phenylbenzene?
The IUPAC name of 2-tert-butyl-1,3-dimethyl-4-phenylbenzene (CID 164927310) is 2-tert-butyl-1,3-dimethyl-4-phenylbenzene.
What is the SMILES notation for 2-tert-butyl-1,3-dimethyl-4-phenylbenzene?
The canonical SMILES for 2-tert-butyl-1,3-dimethyl-4-phenylbenzene is Cc1ccc(-c2ccccc2)c(C)c1C(C)(C)C.
What is the InChIKey of 2-tert-butyl-1,3-dimethyl-4-phenylbenzene?
The InChIKey is XDNAHXJESVNEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22/c1-13-11-12-16(15-9-7-6-8-10-15)14(2)17(13)18(3,4)5/h6-12H,1-5H3.
What are the key properties of 2-tert-butyl-1,3-dimethyl-4-phenylbenzene?
2-tert-butyl-1,3-dimethyl-4-phenylbenzene has a molecular weight of 238.37 g/mol, XLogP of 5.27, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,3-dimethyl-4-phenylbenzene is sourced from PubChem (CID 164927310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).