C17H18F2 — CID 164927245
3-tert-butyl-2,4-difluoro-1-methyl-5-phenylbenzene (PubChem CID 164927245) has the molecular formula C17H18F2 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-tert-butyl-2,4-difluoro-1-methyl-5-phenylbenzene.
| Compound Name | 3-tert-butyl-2,4-difluoro-1-methyl-5-phenylbenzene |
|---|---|
| PubChem CID | 164927245 |
| Molecular Formula | C17H18F2 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-tert-butyl-2,4-difluoro-1-methyl-5-phenylbenzene |
| SMILES | Cc1cc(-c2ccccc2)c(F)c(C(C)(C)C)c1F |
| InChI | InChI=1S/C17H18F2/c1-11-10-13(12-8-6-5-7-9-12)16(19)14(15(11)18)17(2,3)4/h5-10H,1-4H3 |
| InChIKey | UFWDIZFCOBZIHN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |