C21H14F6 — CID 173305938
1-methyl-3,5-diphenyl-2,4-bis(trifluoromethyl)benzene (PubChem CID 173305938) has the molecular formula C21H14F6 and a molecular weight of 380.33 g/mol. Its IUPAC name is 1-methyl-3,5-diphenyl-2,4-bis(trifluoromethyl)benzene.
| Compound Name | 1-methyl-3,5-diphenyl-2,4-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 173305938 |
| Molecular Formula | C21H14F6 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-methyl-3,5-diphenyl-2,4-bis(trifluoromethyl)benzene |
| SMILES | Cc1cc(-c2ccccc2)c(C(F)(F)F)c(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C21H14F6/c1-13-12-16(14-8-4-2-5-9-14)19(21(25,26)27)17(18(13)20(22,23)24)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | YPWFZEVHGYKKNC-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |