C29H23F3O2 — CID 23018914
3,5-diphenyl-4-(trifluoromethyl)-2-(2,4,6-trimethylphenyl)benzoic acid (PubChem CID 23018914) has the molecular formula C29H23F3O2 and a molecular weight of 460.50 g/mol. Its IUPAC name is 3,5-diphenyl-4-(trifluoromethyl)-2-(2,4,6-trimethylphenyl)benzoic acid.
| Compound Name | 3,5-diphenyl-4-(trifluoromethyl)-2-(2,4,6-trimethylphenyl)benzoic acid |
|---|---|
| PubChem CID | 23018914 |
| Molecular Formula | C29H23F3O2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 3,5-diphenyl-4-(trifluoromethyl)-2-(2,4,6-trimethylphenyl)benzoic acid |
| SMILES | Cc1cc(C)c(-c2c(C(=O)O)cc(-c3ccccc3)c(C(F)(F)F)c2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H23F3O2/c1-17-14-18(2)24(19(3)15-17)26-23(28(33)34)16-22(20-10-6-4-7-11-20)27(29(30,31)32)25(26)21-12-8-5-9-13-21/h4-16H,1-3H3,(H,33,34) |
| InChIKey | ANMOSSJGHBYUHU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |