C10H6F6O2 — CID 119020616
5-methyl-2,3-bis(trifluoromethyl)benzoic acid (PubChem CID 119020616) has the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 5-methyl-2,3-bis(trifluoromethyl)benzoic acid.
| Compound Name | 5-methyl-2,3-bis(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 119020616 |
| Molecular Formula | C10H6F6O2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5-methyl-2,3-bis(trifluoromethyl)benzoic acid |
| SMILES | Cc1cc(C(=O)O)c(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H6F6O2/c1-4-2-5(8(17)18)7(10(14,15)16)6(3-4)9(11,12)13/h2-3H,1H3,(H,17,18) |
| InChIKey | UMTFPDKPIZLKCR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |