C12H15F3O2 — CID 177201270
2,5-dimethyl-3-(trifluoromethyl)benzoic acid;ethane (PubChem CID 177201270) has the molecular formula C12H15F3O2 and a molecular weight of 248.24 g/mol. Its IUPAC name is 2,5-dimethyl-3-(trifluoromethyl)benzoic acid;ethane.
| Compound Name | 2,5-dimethyl-3-(trifluoromethyl)benzoic acid;ethane |
|---|---|
| PubChem CID | 177201270 |
| Molecular Formula | C12H15F3O2 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2,5-dimethyl-3-(trifluoromethyl)benzoic acid;ethane |
| SMILES | CC.Cc1cc(C(=O)O)c(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3O2.C2H6/c1-5-3-7(9(14)15)6(2)8(4-5)10(11,12)13;1-2/h3-4H,1-2H3,(H,14,15);1-2H3 |
| InChIKey | CRSJTEBABIQJGD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |