C9H5BrF6 — CID 135743181
1-bromo-5-methyl-2,3-bis(trifluoromethyl)benzene (PubChem CID 135743181) has the molecular formula C9H5BrF6 and a molecular weight of 307.03 g/mol. Its IUPAC name is 1-bromo-5-methyl-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 1-bromo-5-methyl-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 135743181 |
| Molecular Formula | C9H5BrF6 |
| Molecular Weight | 307.03 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 1-bromo-5-methyl-2,3-bis(trifluoromethyl)benzene |
| SMILES | Cc1cc(Br)c(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H5BrF6/c1-4-2-5(8(11,12)13)7(6(10)3-4)9(14,15)16/h2-3H,1H3 |
| InChIKey | DSYRJJAUEZVWSS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.03 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |