C8H4BrF5 — CID 170917204
1-bromo-4,5-difluoro-3-methyl-2-(trifluoromethyl)benzene (PubChem CID 170917204) has the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. Its IUPAC name is 1-bromo-4,5-difluoro-3-methyl-2-(trifluoromethyl)benzene.
| Compound Name | 1-bromo-4,5-difluoro-3-methyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 170917204 |
| Molecular Formula | C8H4BrF5 |
| Molecular Weight | 275.01 g/mol |
| Exact Mass | 273.94 |
| IUPAC Name | 1-bromo-4,5-difluoro-3-methyl-2-(trifluoromethyl)benzene |
| SMILES | Cc1c(F)c(F)cc(Br)c1C(F)(F)F |
| InChI | InChI=1S/C8H4BrF5/c1-3-6(8(12,13)14)4(9)2-5(10)7(3)11/h2H,1H3 |
| InChIKey | PHJJCZJEYJVARG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.01 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|