C9HBr2F9 — CID 162536983
1,5-dibromo-2,3,4-tris(trifluoromethyl)benzene (PubChem CID 162536983) has the molecular formula C9HBr2F9 and a molecular weight of 439.90 g/mol. Its IUPAC name is 1,5-dibromo-2,3,4-tris(trifluoromethyl)benzene.
| Compound Name | 1,5-dibromo-2,3,4-tris(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 162536983 |
| Molecular Formula | C9HBr2F9 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 437.83 |
| IUPAC Name | 1,5-dibromo-2,3,4-tris(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1c(Br)cc(Br)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9HBr2F9/c10-2-1-3(11)5(8(15,16)17)6(9(18,19)20)4(2)7(12,13)14/h1H |
| InChIKey | GQYAZWVJJHHNPV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |