C9H2BrF9 — CID 18349903
1-bromo-2,3,4-tris(trifluoromethyl)benzene (PubChem CID 18349903) has the molecular formula C9H2BrF9 and a molecular weight of 361.00 g/mol. Its IUPAC name is 1-bromo-2,3,4-tris(trifluoromethyl)benzene.
| Compound Name | 1-bromo-2,3,4-tris(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 18349903 |
| Molecular Formula | C9H2BrF9 |
| Molecular Weight | 361.00 g/mol |
| Exact Mass | 359.92 |
| IUPAC Name | 1-bromo-2,3,4-tris(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccc(Br)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H2BrF9/c10-4-2-1-3(7(11,12)13)5(8(14,15)16)6(4)9(17,18)19/h1-2H |
| InChIKey | AHRHSQYISZHBTN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.00 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |