C8H3BrF6O — CID 118997062
3-bromo-2,6-bis(trifluoromethyl)phenol (PubChem CID 118997062) has the molecular formula C8H3BrF6O and a molecular weight of 309.00 g/mol. Its IUPAC name is 3-bromo-2,6-bis(trifluoromethyl)phenol.
| Compound Name | 3-bromo-2,6-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 118997062 |
| Molecular Formula | C8H3BrF6O |
| Molecular Weight | 309.00 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 3-bromo-2,6-bis(trifluoromethyl)phenol |
| SMILES | Oc1c(C(F)(F)F)ccc(Br)c1C(F)(F)F |
| InChI | InChI=1S/C8H3BrF6O/c9-4-2-1-3(7(10,11)12)6(16)5(4)8(13,14)15/h1-2,16H |
| InChIKey | VZWHOKHAEVENCT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.00 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |