C10H5BrF6O3 — CID 118995986
2-[3-bromo-2,6-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 118995986) has the molecular formula C10H5BrF6O3 and a molecular weight of 367.04 g/mol. Its IUPAC name is 2-[3-bromo-2,6-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[3-bromo-2,6-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118995986 |
| Molecular Formula | C10H5BrF6O3 |
| Molecular Weight | 367.04 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 2-[3-bromo-2,6-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1c(C(F)(F)F)ccc(Br)c1C(F)(F)F |
| InChI | InChI=1S/C10H5BrF6O3/c11-4-2-1-3(9(12,13)14)5(7(18)8(19)20)6(4)10(15,16)17/h1-2,7,18H,(H,19,20) |
| InChIKey | ZGNKDEWGGVHZPG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.04 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |