C9H7ClF3NO3 — CID 134655848
2-[6-amino-2-chloro-3-(trifluoromethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 134655848) has the molecular formula C9H7ClF3NO3 and a molecular weight of 269.61 g/mol. Its IUPAC name is 2-[6-amino-2-chloro-3-(trifluoromethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[6-amino-2-chloro-3-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134655848 |
| Molecular Formula | C9H7ClF3NO3 |
| Molecular Weight | 269.61 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-[6-amino-2-chloro-3-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | Nc1ccc(C(F)(F)F)c(Cl)c1C(O)C(=O)O |
| InChI | InChI=1S/C9H7ClF3NO3/c10-6-3(9(11,12)13)1-2-4(14)5(6)7(15)8(16)17/h1-2,7,15H,14H2,(H,16,17) |
| InChIKey | VAUNLRKGCLGOSQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.61 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|