C8H4ClF6N — CID 118991382
3-chloro-2,4-bis(trifluoromethyl)aniline (PubChem CID 118991382) has the molecular formula C8H4ClF6N and a molecular weight of 263.57 g/mol. Its IUPAC name is 3-chloro-2,4-bis(trifluoromethyl)aniline.
| Compound Name | 3-chloro-2,4-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 118991382 |
| Molecular Formula | C8H4ClF6N |
| Molecular Weight | 263.57 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 3-chloro-2,4-bis(trifluoromethyl)aniline |
| SMILES | Nc1ccc(C(F)(F)F)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C8H4ClF6N/c9-6-3(7(10,11)12)1-2-4(16)5(6)8(13,14)15/h1-2H,16H2 |
| InChIKey | DXTWUWBAJCYHJR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|