C7H4Cl2F3N — CID 21257594
2,3-dichloro-6-(trifluoromethyl)aniline (PubChem CID 21257594) has the molecular formula C7H4Cl2F3N and a molecular weight of 230.02 g/mol. Its IUPAC name is 2,3-dichloro-6-(trifluoromethyl)aniline.
| Compound Name | 2,3-dichloro-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 21257594 |
| Molecular Formula | C7H4Cl2F3N |
| Molecular Weight | 230.02 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | 2,3-dichloro-6-(trifluoromethyl)aniline |
| SMILES | Nc1c(C(F)(F)F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C7H4Cl2F3N/c8-4-2-1-3(7(10,11)12)6(13)5(4)9/h1-2H,13H2 |
| InChIKey | NESDKBLXQJESKV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.02 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|