C8H6Cl2F3N — CID 123938398
[2,3-dichloro-6-(trifluoromethyl)phenyl]methanamine (PubChem CID 123938398) has the molecular formula C8H6Cl2F3N and a molecular weight of 244.04 g/mol. Its IUPAC name is [2,3-dichloro-6-(trifluoromethyl)phenyl]methanamine.
| Compound Name | [2,3-dichloro-6-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 123938398 |
| Molecular Formula | C8H6Cl2F3N |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | [2,3-dichloro-6-(trifluoromethyl)phenyl]methanamine |
| SMILES | NCc1c(C(F)(F)F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2F3N/c9-6-2-1-5(8(11,12)13)4(3-14)7(6)10/h1-2H,3,14H2 |
| InChIKey | WHJDVWGCSIJXPG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |