C9H7Cl2F3 — CID 122548871
1,2-dichloro-3-ethyl-4-(trifluoromethyl)benzene (PubChem CID 122548871) has the molecular formula C9H7Cl2F3 and a molecular weight of 243.06 g/mol. Its IUPAC name is 1,2-dichloro-3-ethyl-4-(trifluoromethyl)benzene.
| Compound Name | 1,2-dichloro-3-ethyl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 122548871 |
| Molecular Formula | C9H7Cl2F3 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 1,2-dichloro-3-ethyl-4-(trifluoromethyl)benzene |
| SMILES | CCc1c(C(F)(F)F)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl2F3/c1-2-5-6(9(12,13)14)3-4-7(10)8(5)11/h3-4H,2H2,1H3 |
| InChIKey | VDJSSDPOFYMJKT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |