C11H12ClF3 — CID 176694271
3-chloro-1,2-diethyl-4-(trifluoromethyl)benzene (PubChem CID 176694271) has the molecular formula C11H12ClF3 and a molecular weight of 236.66 g/mol. Its IUPAC name is 3-chloro-1,2-diethyl-4-(trifluoromethyl)benzene.
| Compound Name | 3-chloro-1,2-diethyl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 176694271 |
| Molecular Formula | C11H12ClF3 |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-chloro-1,2-diethyl-4-(trifluoromethyl)benzene |
| SMILES | CCc1ccc(C(F)(F)F)c(Cl)c1CC |
| InChI | InChI=1S/C11H12ClF3/c1-3-7-5-6-9(11(13,14)15)10(12)8(7)4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | MZOXDXDVMYHJAE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |