C11H7F6N — CID 135742790
6-ethyl-2,3-bis(trifluoromethyl)benzonitrile (PubChem CID 135742790) has the molecular formula C11H7F6N and a molecular weight of 267.17 g/mol. Its IUPAC name is 6-ethyl-2,3-bis(trifluoromethyl)benzonitrile.
| Compound Name | 6-ethyl-2,3-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 135742790 |
| Molecular Formula | C11H7F6N |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 6-ethyl-2,3-bis(trifluoromethyl)benzonitrile |
| SMILES | CCc1ccc(C(F)(F)F)c(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C11H7F6N/c1-2-6-3-4-8(10(12,13)14)9(7(6)5-18)11(15,16)17/h3-4H,2H2,1H3 |
| InChIKey | OUZUUAJIOKHXFH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |