C12H10F3NO3 — CID 134654225
ethyl 2-[2-cyano-3-hydroxy-4-(trifluoromethyl)phenyl]acetate (PubChem CID 134654225) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is ethyl 2-[2-cyano-3-hydroxy-4-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[2-cyano-3-hydroxy-4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134654225 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | ethyl 2-[2-cyano-3-hydroxy-4-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(F)(F)F)c(O)c1C#N |
| InChI | InChI=1S/C12H10F3NO3/c1-2-19-10(17)5-7-3-4-9(12(13,14)15)11(18)8(7)6-16/h3-4,18H,2,5H2,1H3 |
| InChIKey | HGJVTSVWFFFRBH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |