C13H12F3NO3 — CID 134655342
ethyl 2-[2-cyano-4-(hydroxymethyl)-3-(trifluoromethyl)phenyl]acetate (PubChem CID 134655342) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is ethyl 2-[2-cyano-4-(hydroxymethyl)-3-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[2-cyano-4-(hydroxymethyl)-3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134655342 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | ethyl 2-[2-cyano-4-(hydroxymethyl)-3-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(CO)c(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C13H12F3NO3/c1-2-20-11(19)5-8-3-4-9(7-18)12(10(8)6-17)13(14,15)16/h3-4,18H,2,5,7H2,1H3 |
| InChIKey | CUXVEPYFDRVJON-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |