C13H13F2NO3 — CID 134653748
ethyl 2-[2-cyano-3-(difluoromethyl)-6-(hydroxymethyl)phenyl]acetate (PubChem CID 134653748) has the molecular formula C13H13F2NO3 and a molecular weight of 269.25 g/mol. Its IUPAC name is ethyl 2-[2-cyano-3-(difluoromethyl)-6-(hydroxymethyl)phenyl]acetate.
| Compound Name | ethyl 2-[2-cyano-3-(difluoromethyl)-6-(hydroxymethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134653748 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | ethyl 2-[2-cyano-3-(difluoromethyl)-6-(hydroxymethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1c(CO)ccc(C(F)F)c1C#N |
| InChI | InChI=1S/C13H13F2NO3/c1-2-19-12(18)5-10-8(7-17)3-4-9(13(14)15)11(10)6-16/h3-4,13,17H,2,5,7H2,1H3 |
| InChIKey | QFSJEJRXRBXIEM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |