C12H10F3NO2S — CID 134654174
ethyl 2-[2-cyano-5-sulfanyl-3-(trifluoromethyl)phenyl]acetate (PubChem CID 134654174) has the molecular formula C12H10F3NO2S and a molecular weight of 289.28 g/mol. Its IUPAC name is ethyl 2-[2-cyano-5-sulfanyl-3-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[2-cyano-5-sulfanyl-3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134654174 |
| Molecular Formula | C12H10F3NO2S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | ethyl 2-[2-cyano-5-sulfanyl-3-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(S)cc(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C12H10F3NO2S/c1-2-18-11(17)4-7-3-8(19)5-10(9(7)6-16)12(13,14)15/h3,5,19H,2,4H2,1H3 |
| InChIKey | GKBYHSPZMWWBQD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|