C13H10F5NO2 — CID 134654799
ethyl 2-[2-cyano-3-(difluoromethyl)-5-(trifluoromethyl)phenyl]acetate (PubChem CID 134654799) has the molecular formula C13H10F5NO2 and a molecular weight of 307.22 g/mol. Its IUPAC name is ethyl 2-[2-cyano-3-(difluoromethyl)-5-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[2-cyano-3-(difluoromethyl)-5-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134654799 |
| Molecular Formula | C13H10F5NO2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | ethyl 2-[2-cyano-3-(difluoromethyl)-5-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(F)(F)F)cc(C(F)F)c1C#N |
| InChI | InChI=1S/C13H10F5NO2/c1-2-21-11(20)4-7-3-8(13(16,17)18)5-9(12(14)15)10(7)6-19/h3,5,12H,2,4H2,1H3 |
| InChIKey | IEMATNVGFYJHAZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |