C11H6F3NO3 — CID 119007173
2-[2-cyano-4-formyl-3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 119007173) has the molecular formula C11H6F3NO3 and a molecular weight of 257.17 g/mol. Its IUPAC name is 2-[2-cyano-4-formyl-3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[2-cyano-4-formyl-3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 119007173 |
| Molecular Formula | C11H6F3NO3 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-[2-cyano-4-formyl-3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | N#Cc1c(CC(=O)O)ccc(C=O)c1C(F)(F)F |
| InChI | InChI=1S/C11H6F3NO3/c12-11(13,14)10-7(5-16)2-1-6(3-9(17)18)8(10)4-15/h1-2,5H,3H2,(H,17,18) |
| InChIKey | YODYUVYCJIPVBA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|