C12H10F6O3 — CID 118997873
2-[6-ethyl-2,3-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid (PubChem CID 118997873) has the molecular formula C12H10F6O3 and a molecular weight of 316.20 g/mol. Its IUPAC name is 2-[6-ethyl-2,3-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[6-ethyl-2,3-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118997873 |
| Molecular Formula | C12H10F6O3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-[6-ethyl-2,3-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| SMILES | CCc1ccc(C(F)(F)F)c(C(F)(F)F)c1C(O)C(=O)O |
| InChI | InChI=1S/C12H10F6O3/c1-2-5-3-4-6(11(13,14)15)8(12(16,17)18)7(5)9(19)10(20)21/h3-4,9,19H,2H2,1H3,(H,20,21) |
| InChIKey | IWSXJPMQHYUJGI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |