C10H5F6NO5 — CID 119002692
2-hydroxy-2-[6-nitro-2,3-bis(trifluoromethyl)phenyl]acetic acid (PubChem CID 119002692) has the molecular formula C10H5F6NO5 and a molecular weight of 333.14 g/mol. Its IUPAC name is 2-hydroxy-2-[6-nitro-2,3-bis(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[6-nitro-2,3-bis(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 119002692 |
| Molecular Formula | C10H5F6NO5 |
| Molecular Weight | 333.14 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-hydroxy-2-[6-nitro-2,3-bis(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)C(O)c1c([N+](=O)[O-])ccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H5F6NO5/c11-9(12,13)3-1-2-4(17(21)22)5(7(18)8(19)20)6(3)10(14,15)16/h1-2,7,18H,(H,19,20) |
| InChIKey | YIHUHPMTGOKPMQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.14 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|