C9H6F3NO6 — CID 134656054
2-hydroxy-2-[4-nitro-3-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 134656054) has the molecular formula C9H6F3NO6 and a molecular weight of 281.14 g/mol. Its IUPAC name is 2-hydroxy-2-[4-nitro-3-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-hydroxy-2-[4-nitro-3-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 134656054 |
| Molecular Formula | C9H6F3NO6 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2-hydroxy-2-[4-nitro-3-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)C(O)c1ccc([N+](=O)[O-])c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F3NO6/c10-9(11,12)19-6-3-4(7(14)8(15)16)1-2-5(6)13(17)18/h1-3,7,14H,(H,15,16) |
| InChIKey | ISKYCURVQRQDAU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|